C13H21NO — CID 11694148
(1S,2R,3S)-1-but-3-enyl-3-hydroxy-2,3-dimethylcyclohexane-1-carbonitrile (PubChem CID 11694148) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (1S,2R,3S)-1-but-3-enyl-3-hydroxy-2,3-dimethylcyclohexane-1-carbonitrile.
| Compound Name | (1S,2R,3S)-1-but-3-enyl-3-hydroxy-2,3-dimethylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 11694148 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (1S,2R,3S)-1-but-3-enyl-3-hydroxy-2,3-dimethylcyclohexane-1-carbonitrile |
| SMILES | C=CCC[C@@]1(C#N)CCC[C@](C)(O)[C@@H]1C |
| InChI | InChI=1S/C13H21NO/c1-4-5-8-13(10-14)9-6-7-12(3,15)11(13)2/h4,11,15H,1,5-9H2,2-3H3/t11-,12-,13-/m0/s1 |
| InChIKey | VWSUWYHIVQOPOF-AVGNSLFASA-N |
| XLogP | 3.03 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|