C17H21NO — CID 11161155
(4S,4aS,8R,8aS)-8-but-3-enyl-4,8-dimethyl-5-oxo-4,8a-dihydro-1H-naphthalene-4a-carbonitrile (PubChem CID 11161155) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is (4S,4aS,8R,8aS)-8-but-3-enyl-4,8-dimethyl-5-oxo-4,8a-dihydro-1H-naphthalene-4a-carbonitrile.
| Compound Name | (4S,4aS,8R,8aS)-8-but-3-enyl-4,8-dimethyl-5-oxo-4,8a-dihydro-1H-naphthalene-4a-carbonitrile |
|---|---|
| PubChem CID | 11161155 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (4S,4aS,8R,8aS)-8-but-3-enyl-4,8-dimethyl-5-oxo-4,8a-dihydro-1H-naphthalene-4a-carbonitrile |
| SMILES | C=CCC[C@]1(C)C=CC(=O)[C@]2(C#N)[C@H]1CC=C[C@@H]2C |
| InChI | InChI=1S/C17H21NO/c1-4-5-10-16(3)11-9-15(19)17(12-18)13(2)7-6-8-14(16)17/h4,6-7,9,11,13-14H,1,5,8,10H2,2-3H3/t13-,14-,16+,17-/m0/s1 |
| InChIKey | MYATUYUKNGTACB-DIECFANBSA-N |
| XLogP | 3.82 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|