C17H22O4 — CID 11022615
ethyl 3-[(1R,4aS,8aS)-4a-formyl-1-methyl-4-oxo-8,8a-dihydro-5H-naphthalen-1-yl]propanoate (PubChem CID 11022615) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is ethyl 3-[(1R,4aS,8aS)-4a-formyl-1-methyl-4-oxo-8,8a-dihydro-5H-naphthalen-1-yl]propanoate.
| Compound Name | ethyl 3-[(1R,4aS,8aS)-4a-formyl-1-methyl-4-oxo-8,8a-dihydro-5H-naphthalen-1-yl]propanoate |
|---|---|
| PubChem CID | 11022615 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | ethyl 3-[(1R,4aS,8aS)-4a-formyl-1-methyl-4-oxo-8,8a-dihydro-5H-naphthalen-1-yl]propanoate |
| SMILES | CCOC(=O)CC[C@]1(C)C=CC(=O)[C@@]2(C=O)CC=CC[C@@H]12 |
| InChI | InChI=1S/C17H22O4/c1-3-21-15(20)8-11-16(2)10-7-14(19)17(12-18)9-5-4-6-13(16)17/h4-5,7,10,12-13H,3,6,8-9,11H2,1-2H3/t13-,16-,17+/m0/s1 |
| InChIKey | WSGIBPPHAKATFZ-RRQGHBQHSA-N |
| XLogP | 2.63 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|