C9H17N3 — CID 116948881
1-N-methyl-1-(1H-pyrrol-2-yl)butane-1,3-diamine (PubChem CID 116948881) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 1-N-methyl-1-(1H-pyrrol-2-yl)butane-1,3-diamine.
| Compound Name | 1-N-methyl-1-(1H-pyrrol-2-yl)butane-1,3-diamine |
|---|---|
| PubChem CID | 116948881 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 1-N-methyl-1-(1H-pyrrol-2-yl)butane-1,3-diamine |
| SMILES | CNC(CC(C)N)c1ccc[nH]1 |
| InChI | InChI=1S/C9H17N3/c1-7(10)6-9(11-2)8-4-3-5-12-8/h3-5,7,9,11-12H,6,10H2,1-2H3 |
| InChIKey | LTEAOORJOWHHND-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |