C9H17N3 — CID 70457656
N'-[1-(1H-pyrrol-2-yl)propyl]ethane-1,2-diamine (PubChem CID 70457656) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is N'-[1-(1H-pyrrol-2-yl)propyl]ethane-1,2-diamine.
| Compound Name | N'-[1-(1H-pyrrol-2-yl)propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 70457656 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | N'-[1-(1H-pyrrol-2-yl)propyl]ethane-1,2-diamine |
| SMILES | CCC(NCCN)c1ccc[nH]1 |
| InChI | InChI=1S/C9H17N3/c1-2-8(12-7-5-10)9-4-3-6-11-9/h3-4,6,8,11-12H,2,5,7,10H2,1H3 |
| InChIKey | MKCZWPLXGCJGLC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |