C16H19N3O3 — CID 70548324
5-amino-N-[1-(1H-pyrrol-2-yl)propyl]-2,3-dihydro-1,4-benzodioxine-8-carboxamide (PubChem CID 70548324) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 5-amino-N-[1-(1H-pyrrol-2-yl)propyl]-2,3-dihydro-1,4-benzodioxine-8-carboxamide.
| Compound Name | 5-amino-N-[1-(1H-pyrrol-2-yl)propyl]-2,3-dihydro-1,4-benzodioxine-8-carboxamide |
|---|---|
| PubChem CID | 70548324 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 5-amino-N-[1-(1H-pyrrol-2-yl)propyl]-2,3-dihydro-1,4-benzodioxine-8-carboxamide |
| SMILES | CCC(NC(=O)c1ccc(N)c2c1OCCO2)c1ccc[nH]1 |
| InChI | InChI=1S/C16H19N3O3/c1-2-12(13-4-3-7-18-13)19-16(20)10-5-6-11(17)15-14(10)21-8-9-22-15/h3-7,12,18H,2,8-9,17H2,1H3,(H,19,20) |
| InChIKey | URDGCWYBGSCRRB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|