C14H19N3O2 — CID 116951071
6-[methylamino(pyrrolidin-3-yl)methyl]-4H-1,4-benzoxazin-3-one (PubChem CID 116951071) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 6-[methylamino(pyrrolidin-3-yl)methyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[methylamino(pyrrolidin-3-yl)methyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 116951071 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 6-[methylamino(pyrrolidin-3-yl)methyl]-4H-1,4-benzoxazin-3-one |
| SMILES | CNC(c1ccc2c(c1)NC(=O)CO2)C1CCNC1 |
| InChI | InChI=1S/C14H19N3O2/c1-15-14(10-4-5-16-7-10)9-2-3-12-11(6-9)17-13(18)8-19-12/h2-3,6,10,14-16H,4-5,7-8H2,1H3,(H,17,18) |
| InChIKey | IEXSDVDBDVLZIF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |