C15H21NO3 — CID 116957005
4-[1,3-benzodioxol-5-yl(methylamino)methyl]cyclohexan-1-ol (PubChem CID 116957005) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-[1,3-benzodioxol-5-yl(methylamino)methyl]cyclohexan-1-ol.
| Compound Name | 4-[1,3-benzodioxol-5-yl(methylamino)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 116957005 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 4-[1,3-benzodioxol-5-yl(methylamino)methyl]cyclohexan-1-ol |
| SMILES | CNC(c1ccc2c(c1)OCO2)C1CCC(O)CC1 |
| InChI | InChI=1S/C15H21NO3/c1-16-15(10-2-5-12(17)6-3-10)11-4-7-13-14(8-11)19-9-18-13/h4,7-8,10,12,15-17H,2-3,5-6,9H2,1H3 |
| InChIKey | JVTPYHJBTKKOMJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |