C19H28O5 — CID 11695733
(3S,5R,8S,9S,10S,13S,14S,17S)-3,4,17-trihydroxy-13-methyl-6-oxo-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-10-carbaldehyde (PubChem CID 11695733) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is (3S,5R,8S,9S,10S,13S,14S,17S)-3,4,17-trihydroxy-13-methyl-6-oxo-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-10-carbaldehyde.
| Compound Name | (3S,5R,8S,9S,10S,13S,14S,17S)-3,4,17-trihydroxy-13-methyl-6-oxo-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-10-carbaldehyde |
|---|---|
| PubChem CID | 11695733 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (3S,5R,8S,9S,10S,13S,14S,17S)-3,4,17-trihydroxy-13-methyl-6-oxo-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-10-carbaldehyde |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC(=O)[C@H]4C(O)[C@@H](O)CC[C@@]43C=O)[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C19H28O5/c1-18-6-4-12-10(11(18)2-3-15(18)23)8-14(22)16-17(24)13(21)5-7-19(12,16)9-20/h9-13,15-17,21,23-24H,2-8H2,1H3/t10-,11-,12-,13-,15-,16-,17?,18-,19-/m0/s1 |
| InChIKey | LOCSEESUQNRHHG-SHDQSNLHSA-N |
| XLogP | 1.08 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|