C21H27BrO2 — CID 67897975
(8R,9S,10R,13S,14S,17S)-4-bromo-6-ethylidene-17-hydroxy-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-3-one (PubChem CID 67897975) has the molecular formula C21H27BrO2 and a molecular weight of 391.35 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17S)-4-bromo-6-ethylidene-17-hydroxy-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S,17S)-4-bromo-6-ethylidene-17-hydroxy-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 67897975 |
| Molecular Formula | C21H27BrO2 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (8R,9S,10R,13S,14S,17S)-4-bromo-6-ethylidene-17-hydroxy-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC=C1C[C@H]2[C@@H]3CC[C@H](O)[C@@]3(C)CC[C@@H]2[C@@]2(C)C=CC(=O)C(Br)=C12 |
| InChI | InChI=1S/C21H27BrO2/c1-4-12-11-13-14-5-6-17(24)20(14,2)9-7-15(13)21(3)10-8-16(23)19(22)18(12)21/h4,8,10,13-15,17,24H,5-7,9,11H2,1-3H3/t13-,14-,15-,17-,20-,21+/m0/s1 |
| InChIKey | IQKILMBZFGYYCO-GWEIWVATSA-N |
| XLogP | 4.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|