C16H10F6N2O — CID 11696179
(2E)-2-hydrazinylidene-1,2-bis[4-(trifluoromethyl)phenyl]ethanone (PubChem CID 11696179) has the molecular formula C16H10F6N2O and a molecular weight of 360.26 g/mol. Its IUPAC name is (2E)-2-hydrazinylidene-1,2-bis[4-(trifluoromethyl)phenyl]ethanone.
| Compound Name | (2E)-2-hydrazinylidene-1,2-bis[4-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 11696179 |
| Molecular Formula | C16H10F6N2O |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | (2E)-2-hydrazinylidene-1,2-bis[4-(trifluoromethyl)phenyl]ethanone |
| SMILES | N/N=C(/C(=O)c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H10F6N2O/c17-15(18,19)11-5-1-9(2-6-11)13(24-23)14(25)10-3-7-12(8-4-10)16(20,21)22/h1-8H,23H2/b24-13+ |
| InChIKey | GTOWOSWHKWBLSX-ZMOGYAJESA-N |
| XLogP | 4.27 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|