C14H19NO2S — CID 116962323
6-piperidin-4-yl-3,4-dihydro-2H-thiochromene 1,1-dioxide (PubChem CID 116962323) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is 6-piperidin-4-yl-3,4-dihydro-2H-thiochromene 1,1-dioxide.
| Compound Name | 6-piperidin-4-yl-3,4-dihydro-2H-thiochromene 1,1-dioxide |
|---|---|
| PubChem CID | 116962323 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 6-piperidin-4-yl-3,4-dihydro-2H-thiochromene 1,1-dioxide |
| SMILES | O=S1(=O)CCCc2cc(C3CCNCC3)ccc21 |
| InChI | InChI=1S/C14H19NO2S/c16-18(17)9-1-2-13-10-12(3-4-14(13)18)11-5-7-15-8-6-11/h3-4,10-11,15H,1-2,5-9H2 |
| InChIKey | IXJJANLJFAYRAG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |