2-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]acetic acid

C9H8N2O2S — CID 116965645

IUPAC2-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]acetic acid
SMILESO=C(O)Cc1nc(-c2ccc[nH]2)cs1
InChIInChI=1S/C9H8N2O2S/c12-9(13)4-8-11-7(5-14-8)6-2-1-3-10-6/h1-3,5,10H,4H2,(H,12,13)
InChIKeyUOVKCHVRVDPPAK-UHFFFAOYSA-N
MW208.24 g/mol
LogP1.77
Rot. Bonds3

About 2-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]acetic acid

2-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]acetic acid (PubChem CID 116965645) has the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. Its IUPAC name is 2-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]acetic acid.

Molecular Properties

Compound Name2-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]acetic acid
PubChem CID116965645
Molecular FormulaC9H8N2O2S
Molecular Weight208.24 g/mol
Exact Mass208.03
IUPAC Name2-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]acetic acid
SMILESO=C(O)Cc1nc(-c2ccc[nH]2)cs1
InChIInChI=1S/C9H8N2O2S/c12-9(13)4-8-11-7(5-14-8)6-2-1-3-10-6/h1-3,5,10H,4H2,(H,12,13)
InChIKeyUOVKCHVRVDPPAK-UHFFFAOYSA-N
XLogP1.77
TPSA65.98 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.24
LogP ≤ 51.77
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]acetic acid?
The IUPAC name of 2-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]acetic acid (CID 116965645) is 2-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]acetic acid.
What is the SMILES notation for 2-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]acetic acid?
The canonical SMILES for 2-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]acetic acid is O=C(O)Cc1nc(-c2ccc[nH]2)cs1.
What is the InChIKey of 2-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]acetic acid?
The InChIKey is UOVKCHVRVDPPAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2S/c12-9(13)4-8-11-7(5-14-8)6-2-1-3-10-6/h1-3,5,10H,4H2,(H,12,13).
What are the key properties of 2-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]acetic acid?
2-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]acetic acid has a molecular weight of 208.24 g/mol, XLogP of 1.77, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]acetic acid is sourced from PubChem (CID 116965645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).