3-amino-3-[2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]propanoic acid

C10H11N3O2S — CID 136988948

IUPAC3-amino-3-[2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]propanoic acid
SMILESNC(CC(=O)O)c1csc(-c2ccc[nH]2)n1
InChIInChI=1S/C10H11N3O2S/c11-6(4-9(14)15)8-5-16-10(13-8)7-2-1-3-12-7/h1-3,5-6,12H,4,11H2,(H,14,15)
InChIKeyXYWDKSNWRWFOCP-UHFFFAOYSA-N
MW237.28 g/mol
LogP1.61
Rot. Bonds4

About 3-amino-3-[2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]propanoic acid

3-amino-3-[2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 136988948) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is 3-amino-3-[2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]propanoic acid.

Molecular Properties

Compound Name3-amino-3-[2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]propanoic acid
PubChem CID136988948
Molecular FormulaC10H11N3O2S
Molecular Weight237.28 g/mol
Exact Mass237.06
IUPAC Name3-amino-3-[2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]propanoic acid
SMILESNC(CC(=O)O)c1csc(-c2ccc[nH]2)n1
InChIInChI=1S/C10H11N3O2S/c11-6(4-9(14)15)8-5-16-10(13-8)7-2-1-3-12-7/h1-3,5-6,12H,4,11H2,(H,14,15)
InChIKeyXYWDKSNWRWFOCP-UHFFFAOYSA-N
XLogP1.61
TPSA92.00 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.28
LogP ≤ 51.61
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 3-amino-3-[2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-3-[2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]propanoic acid?
The IUPAC name of 3-amino-3-[2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]propanoic acid (CID 136988948) is 3-amino-3-[2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]propanoic acid.
What is the SMILES notation for 3-amino-3-[2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]propanoic acid?
The canonical SMILES for 3-amino-3-[2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]propanoic acid is NC(CC(=O)O)c1csc(-c2ccc[nH]2)n1.
What is the InChIKey of 3-amino-3-[2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]propanoic acid?
The InChIKey is XYWDKSNWRWFOCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2S/c11-6(4-9(14)15)8-5-16-10(13-8)7-2-1-3-12-7/h1-3,5-6,12H,4,11H2,(H,14,15).
What are the key properties of 3-amino-3-[2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]propanoic acid?
3-amino-3-[2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]propanoic acid has a molecular weight of 237.28 g/mol, XLogP of 1.61, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-[2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]propanoic acid is sourced from PubChem (CID 136988948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).