C8H10N2O2S — CID 55273447
(3S)-3-amino-3-(2-sulfanylidene-1H-pyridin-3-yl)propanoic acid (PubChem CID 55273447) has the molecular formula C8H10N2O2S and a molecular weight of 198.25 g/mol. Its IUPAC name is (3S)-3-amino-3-(2-sulfanylidene-1H-pyridin-3-yl)propanoic acid.
| Compound Name | (3S)-3-amino-3-(2-sulfanylidene-1H-pyridin-3-yl)propanoic acid |
|---|---|
| PubChem CID | 55273447 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | (3S)-3-amino-3-(2-sulfanylidene-1H-pyridin-3-yl)propanoic acid |
| SMILES | N[C@@H](CC(=O)O)c1ccc[nH]c1=S |
| InChI | InChI=1S/C8H10N2O2S/c9-6(4-7(11)12)5-2-1-3-10-8(5)13/h1-3,6H,4,9H2,(H,10,13)(H,11,12)/t6-/m0/s1 |
| InChIKey | WSDYJXAABZSMKS-LURJTMIESA-N |
| XLogP | 1.22 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|