C13H11N3OS2 — CID 24687215
N-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]-2-thiophen-3-ylacetamide (PubChem CID 24687215) has the molecular formula C13H11N3OS2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]-2-thiophen-3-ylacetamide.
| Compound Name | N-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 24687215 |
| Molecular Formula | C13H11N3OS2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | N-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]-2-thiophen-3-ylacetamide |
| SMILES | O=C(Cc1ccsc1)Nc1nc(-c2ccc[nH]2)cs1 |
| InChI | InChI=1S/C13H11N3OS2/c17-12(6-9-3-5-18-7-9)16-13-15-11(8-19-13)10-2-1-4-14-10/h1-5,7-8,14H,6H2,(H,15,16,17) |
| InChIKey | KJACPKUGRXNSFK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |