C13H11NO2S — CID 116965816
2-(4-phenyl-1,3-thiazol-2-yl)cyclopropane-1-carboxylic acid (PubChem CID 116965816) has the molecular formula C13H11NO2S and a molecular weight of 245.30 g/mol. Its IUPAC name is 2-(4-phenyl-1,3-thiazol-2-yl)cyclopropane-1-carboxylic acid.
| Compound Name | 2-(4-phenyl-1,3-thiazol-2-yl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 116965816 |
| Molecular Formula | C13H11NO2S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-(4-phenyl-1,3-thiazol-2-yl)cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1CC1c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C13H11NO2S/c15-13(16)10-6-9(10)12-14-11(7-17-12)8-4-2-1-3-5-8/h1-5,7,9-10H,6H2,(H,15,16) |
| InChIKey | KBXGDHUXRUDMDN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |