C13H15NOS2 — CID 116966067
4-(2-methoxy-3,4,6-trimethylphenyl)-3H-1,3-thiazole-2-thione (PubChem CID 116966067) has the molecular formula C13H15NOS2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 4-(2-methoxy-3,4,6-trimethylphenyl)-3H-1,3-thiazole-2-thione.
| Compound Name | 4-(2-methoxy-3,4,6-trimethylphenyl)-3H-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 116966067 |
| Molecular Formula | C13H15NOS2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 4-(2-methoxy-3,4,6-trimethylphenyl)-3H-1,3-thiazole-2-thione |
| SMILES | COc1c(C)c(C)cc(C)c1-c1csc(=S)[nH]1 |
| InChI | InChI=1S/C13H15NOS2/c1-7-5-8(2)11(12(15-4)9(7)3)10-6-17-13(16)14-10/h5-6H,1-4H3,(H,14,16) |
| InChIKey | OTQHUCLBKRCAAP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|