C13H16N2OS — CID 116966606
4-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]cyclohexan-1-ol (PubChem CID 116966606) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is 4-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]cyclohexan-1-ol.
| Compound Name | 4-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 116966606 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 4-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]cyclohexan-1-ol |
| SMILES | OC1CCC(c2nc(-c3ccc[nH]3)cs2)CC1 |
| InChI | InChI=1S/C13H16N2OS/c16-10-5-3-9(4-6-10)13-15-12(8-17-13)11-2-1-7-14-11/h1-2,7-10,14,16H,3-6H2 |
| InChIKey | QNRYGBOBOUCKNQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |