C15H17N3OS — CID 142207678
3-[(2S)-2-(ethylideneamino)-2-(1,3-thiazol-4-yl)ethyl]-6,7-dihydro-1H-indol-5-ol (PubChem CID 142207678) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is 3-[(2S)-2-(ethylideneamino)-2-(1,3-thiazol-4-yl)ethyl]-6,7-dihydro-1H-indol-5-ol.
| Compound Name | 3-[(2S)-2-(ethylideneamino)-2-(1,3-thiazol-4-yl)ethyl]-6,7-dihydro-1H-indol-5-ol |
|---|---|
| PubChem CID | 142207678 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 3-[(2S)-2-(ethylideneamino)-2-(1,3-thiazol-4-yl)ethyl]-6,7-dihydro-1H-indol-5-ol |
| SMILES | C/C=N/[C@@H](Cc1c[nH]c2c1C=C(O)CC2)c1cscn1 |
| InChI | InChI=1S/C15H17N3OS/c1-2-16-14(15-8-20-9-18-15)5-10-7-17-13-4-3-11(19)6-12(10)13/h2,6-9,14,17,19H,3-5H2,1H3/b16-2+/t14-/m0/s1 |
| InChIKey | VOJXGKYZHHHQGY-UIWHWPOISA-N |
| XLogP | 3.69 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|