About 1-[1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]-N-methylmethanamine
1-[1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]-N-methylmethanamine (PubChem CID 116969393) has the molecular formula C11H18N2S
and a molecular weight of 210.35 g/mol. Its IUPAC name is 1-[1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-[1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]-N-methylmethanamine |
| PubChem CID | 116969393 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 1-[1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]-N-methylmethanamine |
| SMILES | CCc1csc(CC2(CNC)CC2)n1 |
| InChI | InChI=1S/C11H18N2S/c1-3-9-7-14-10(13-9)6-11(4-5-11)8-12-2/h7,12H,3-6,8H2,1-2H3 |
| InChIKey | NHFBQHNBCWKIRS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]-N-methylmethanamine?
The IUPAC name of 1-[1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]-N-methylmethanamine (CID 116969393) is 1-[1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]-N-methylmethanamine.
What is the SMILES notation for 1-[1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]-N-methylmethanamine?
The canonical SMILES for 1-[1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]-N-methylmethanamine is CCc1csc(CC2(CNC)CC2)n1.
What is the InChIKey of 1-[1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]-N-methylmethanamine?
The InChIKey is NHFBQHNBCWKIRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2S/c1-3-9-7-14-10(13-9)6-11(4-5-11)8-12-2/h7,12H,3-6,8H2,1-2H3.
What are the key properties of 1-[1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]-N-methylmethanamine?
1-[1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]-N-methylmethanamine has a molecular weight of 210.35 g/mol, XLogP of 2.25, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]-N-methylmethanamine is sourced from PubChem (CID 116969393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).