C11H14N4S — CID 116970558
1-N-(6-thiophen-2-ylpyridazin-3-yl)propane-1,2-diamine (PubChem CID 116970558) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is 1-N-(6-thiophen-2-ylpyridazin-3-yl)propane-1,2-diamine.
| Compound Name | 1-N-(6-thiophen-2-ylpyridazin-3-yl)propane-1,2-diamine |
|---|---|
| PubChem CID | 116970558 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 1-N-(6-thiophen-2-ylpyridazin-3-yl)propane-1,2-diamine |
| SMILES | CC(N)CNc1ccc(-c2cccs2)nn1 |
| InChI | InChI=1S/C11H14N4S/c1-8(12)7-13-11-5-4-9(14-15-11)10-3-2-6-16-10/h2-6,8H,7,12H2,1H3,(H,13,15) |
| InChIKey | ZJIVPIGKZIRHOA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |