C10H16N4 — CID 116970918
N-(azetidin-3-yl)-6-propylpyridazin-3-amine (PubChem CID 116970918) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is N-(azetidin-3-yl)-6-propylpyridazin-3-amine.
| Compound Name | N-(azetidin-3-yl)-6-propylpyridazin-3-amine |
|---|---|
| PubChem CID | 116970918 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | N-(azetidin-3-yl)-6-propylpyridazin-3-amine |
| SMILES | CCCc1ccc(NC2CNC2)nn1 |
| InChI | InChI=1S/C10H16N4/c1-2-3-8-4-5-10(14-13-8)12-9-6-11-7-9/h4-5,9,11H,2-3,6-7H2,1H3,(H,12,14) |
| InChIKey | ZQEQEBMLVCKIDW-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |