C11H18N4 — CID 116970920
N-(azetidin-3-yl)-6-tert-butylpyridazin-3-amine (PubChem CID 116970920) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is N-(azetidin-3-yl)-6-tert-butylpyridazin-3-amine.
| Compound Name | N-(azetidin-3-yl)-6-tert-butylpyridazin-3-amine |
|---|---|
| PubChem CID | 116970920 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | N-(azetidin-3-yl)-6-tert-butylpyridazin-3-amine |
| SMILES | CC(C)(C)c1ccc(NC2CNC2)nn1 |
| InChI | InChI=1S/C11H18N4/c1-11(2,3)9-4-5-10(15-14-9)13-8-6-12-7-8/h4-5,8,12H,6-7H2,1-3H3,(H,13,15) |
| InChIKey | WLNPHGAUZHUPCJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |