C15H26N6 — CID 118546939
N-(azetidin-3-yl)-6-tert-butyl-2-piperazin-1-ylpyrimidin-4-amine (PubChem CID 118546939) has the molecular formula C15H26N6 and a molecular weight of 290.41 g/mol. Its IUPAC name is N-(azetidin-3-yl)-6-tert-butyl-2-piperazin-1-ylpyrimidin-4-amine.
| Compound Name | N-(azetidin-3-yl)-6-tert-butyl-2-piperazin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 118546939 |
| Molecular Formula | C15H26N6 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | N-(azetidin-3-yl)-6-tert-butyl-2-piperazin-1-ylpyrimidin-4-amine |
| SMILES | CC(C)(C)c1cc(NC2CNC2)nc(N2CCNCC2)n1 |
| InChI | InChI=1S/C15H26N6/c1-15(2,3)12-8-13(18-11-9-17-10-11)20-14(19-12)21-6-4-16-5-7-21/h8,11,16-17H,4-7,9-10H2,1-3H3,(H,18,19,20) |
| InChIKey | OFXXBRQEMCMORG-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |