C14H12N4O — CID 116971877
2-[[6-(2,3-dihydro-1-benzofuran-5-yl)pyridazin-3-yl]amino]acetonitrile (PubChem CID 116971877) has the molecular formula C14H12N4O and a molecular weight of 252.28 g/mol. Its IUPAC name is 2-[[6-(2,3-dihydro-1-benzofuran-5-yl)pyridazin-3-yl]amino]acetonitrile.
| Compound Name | 2-[[6-(2,3-dihydro-1-benzofuran-5-yl)pyridazin-3-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 116971877 |
| Molecular Formula | C14H12N4O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-[[6-(2,3-dihydro-1-benzofuran-5-yl)pyridazin-3-yl]amino]acetonitrile |
| SMILES | N#CCNc1ccc(-c2ccc3c(c2)CCO3)nn1 |
| InChI | InChI=1S/C14H12N4O/c15-6-7-16-14-4-2-12(17-18-14)10-1-3-13-11(9-10)5-8-19-13/h1-4,9H,5,7-8H2,(H,16,18) |
| InChIKey | OKNYSVNJICDGOT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|