C12H15BrFN3O — CID 116981207
1-(2-aminoethyl)-4-(5-bromo-2-fluorophenyl)-3-methylimidazolidin-2-one (PubChem CID 116981207) has the molecular formula C12H15BrFN3O and a molecular weight of 316.17 g/mol. Its IUPAC name is 1-(2-aminoethyl)-4-(5-bromo-2-fluorophenyl)-3-methylimidazolidin-2-one.
| Compound Name | 1-(2-aminoethyl)-4-(5-bromo-2-fluorophenyl)-3-methylimidazolidin-2-one |
|---|---|
| PubChem CID | 116981207 |
| Molecular Formula | C12H15BrFN3O |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 1-(2-aminoethyl)-4-(5-bromo-2-fluorophenyl)-3-methylimidazolidin-2-one |
| SMILES | CN1C(=O)N(CCN)CC1c1cc(Br)ccc1F |
| InChI | InChI=1S/C12H15BrFN3O/c1-16-11(7-17(5-4-15)12(16)18)9-6-8(13)2-3-10(9)14/h2-3,6,11H,4-5,7,15H2,1H3 |
| InChIKey | MJGIHABMEUKSEY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |