About 3-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propanenitrile
3-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propanenitrile (PubChem CID 116986878) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is 3-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propanenitrile.
Analyze 3-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propanenitrile?
The IUPAC name of 3-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propanenitrile (CID 116986878) is 3-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propanenitrile.
What is the SMILES notation for 3-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propanenitrile?
The canonical SMILES for 3-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propanenitrile is N#CCCC12OCC(CO1)CO2.
What is the InChIKey of 3-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propanenitrile?
The InChIKey is FYLLDLOFFSBIPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3/c9-3-1-2-8-10-4-7(5-11-8)6-12-8/h7H,1-2,4-6H2.
What are the key properties of 3-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propanenitrile?
3-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propanenitrile has a molecular weight of 169.18 g/mol, XLogP of 0.64, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propanenitrile is sourced from PubChem (CID 116986878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).