C12H15BrN2O3 — CID 116990825
6-bromo-2-(1-hydroxy-3-methylbutan-2-yl)-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 116990825) has the molecular formula C12H15BrN2O3 and a molecular weight of 315.17 g/mol. Its IUPAC name is 6-bromo-2-(1-hydroxy-3-methylbutan-2-yl)-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 6-bromo-2-(1-hydroxy-3-methylbutan-2-yl)-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 116990825 |
| Molecular Formula | C12H15BrN2O3 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 6-bromo-2-(1-hydroxy-3-methylbutan-2-yl)-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | CC(C)C(CO)C1Oc2ccc(Br)nc2NC1=O |
| InChI | InChI=1S/C12H15BrN2O3/c1-6(2)7(5-16)10-12(17)15-11-8(18-10)3-4-9(13)14-11/h3-4,6-7,10,16H,5H2,1-2H3,(H,14,15,17) |
| InChIKey | PSFWAPZQGSPFIN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|