C13H12N2O2 — CID 116990923
1-(3-oxo-4H-1,4-benzoxazin-2-yl)cyclobutane-1-carbonitrile (PubChem CID 116990923) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 1-(3-oxo-4H-1,4-benzoxazin-2-yl)cyclobutane-1-carbonitrile.
| Compound Name | 1-(3-oxo-4H-1,4-benzoxazin-2-yl)cyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 116990923 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 1-(3-oxo-4H-1,4-benzoxazin-2-yl)cyclobutane-1-carbonitrile |
| SMILES | N#CC1(C2Oc3ccccc3NC2=O)CCC1 |
| InChI | InChI=1S/C13H12N2O2/c14-8-13(6-3-7-13)11-12(16)15-9-4-1-2-5-10(9)17-11/h1-2,4-5,11H,3,6-7H2,(H,15,16) |
| InChIKey | UTQVJACVWLBVLI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |