C10H15F2NO3 — CID 116991783
methyl 2-(3,3-difluoropyrrolidine-1-carbonyl)butanoate (PubChem CID 116991783) has the molecular formula C10H15F2NO3 and a molecular weight of 235.23 g/mol. Its IUPAC name is methyl 2-(3,3-difluoropyrrolidine-1-carbonyl)butanoate.
| Compound Name | methyl 2-(3,3-difluoropyrrolidine-1-carbonyl)butanoate |
|---|---|
| PubChem CID | 116991783 |
| Molecular Formula | C10H15F2NO3 |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | methyl 2-(3,3-difluoropyrrolidine-1-carbonyl)butanoate |
| SMILES | CCC(C(=O)OC)C(=O)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C10H15F2NO3/c1-3-7(9(15)16-2)8(14)13-5-4-10(11,12)6-13/h7H,3-6H2,1-2H3 |
| InChIKey | DOKQPRAWQLFTRG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|