C14H20N2OS — CID 116994662
7-(3-aminobutyl)-2,4-dimethyl-1,4-benzothiazin-3-one (PubChem CID 116994662) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is 7-(3-aminobutyl)-2,4-dimethyl-1,4-benzothiazin-3-one.
| Compound Name | 7-(3-aminobutyl)-2,4-dimethyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 116994662 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 7-(3-aminobutyl)-2,4-dimethyl-1,4-benzothiazin-3-one |
| SMILES | CC(N)CCc1ccc2c(c1)SC(C)C(=O)N2C |
| InChI | InChI=1S/C14H20N2OS/c1-9(15)4-5-11-6-7-12-13(8-11)18-10(2)14(17)16(12)3/h6-10H,4-5,15H2,1-3H3 |
| InChIKey | HNLKKMFYRTUYAB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |