C10H10ClNOS — CID 116994710
7-chloro-2,4-dimethyl-1,4-benzothiazin-3-one (PubChem CID 116994710) has the molecular formula C10H10ClNOS and a molecular weight of 227.72 g/mol. Its IUPAC name is 7-chloro-2,4-dimethyl-1,4-benzothiazin-3-one.
| Compound Name | 7-chloro-2,4-dimethyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 116994710 |
| Molecular Formula | C10H10ClNOS |
| Molecular Weight | 227.72 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | 7-chloro-2,4-dimethyl-1,4-benzothiazin-3-one |
| SMILES | CC1Sc2cc(Cl)ccc2N(C)C1=O |
| InChI | InChI=1S/C10H10ClNOS/c1-6-10(13)12(2)8-4-3-7(11)5-9(8)14-6/h3-6H,1-2H3 |
| InChIKey | RSGLDSXTMKGMNT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.72 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |