C7H6ClNOS2 — CID 102494813
6-chloro-3-methyl-1,2λ4,3-benzodithiazole 2-oxide (PubChem CID 102494813) has the molecular formula C7H6ClNOS2 and a molecular weight of 219.72 g/mol. Its IUPAC name is 6-chloro-3-methyl-1,2λ4,3-benzodithiazole 2-oxide.
| Compound Name | 6-chloro-3-methyl-1,2λ4,3-benzodithiazole 2-oxide |
|---|---|
| PubChem CID | 102494813 |
| Molecular Formula | C7H6ClNOS2 |
| Molecular Weight | 219.72 g/mol |
| Exact Mass | 218.96 |
| IUPAC Name | 6-chloro-3-methyl-1,2λ4,3-benzodithiazole 2-oxide |
| SMILES | CN1c2ccc(Cl)cc2SS1=O |
| InChI | InChI=1S/C7H6ClNOS2/c1-9-6-3-2-5(8)4-7(6)11-12(9)10/h2-4H,1H3 |
| InChIKey | SJGNYMOUDUZEBQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.72 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|