C15H16N2O2 — CID 116995475
6-pyrrolidin-2-yl-2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline (PubChem CID 116995475) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 6-pyrrolidin-2-yl-2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline.
| Compound Name | 6-pyrrolidin-2-yl-2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline |
|---|---|
| PubChem CID | 116995475 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 6-pyrrolidin-2-yl-2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline |
| SMILES | c1cc2cc3c(cc2c(C2CCCN2)n1)OCCO3 |
| InChI | InChI=1S/C15H16N2O2/c1-2-12(16-4-1)15-11-9-14-13(18-6-7-19-14)8-10(11)3-5-17-15/h3,5,8-9,12,16H,1-2,4,6-7H2 |
| InChIKey | RIHQCPZIFXXQNV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |