C14H19NO2S — CID 116995861
2-(7-methyl-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinolin-6-yl)ethanethiol (PubChem CID 116995861) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is 2-(7-methyl-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinolin-6-yl)ethanethiol.
| Compound Name | 2-(7-methyl-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinolin-6-yl)ethanethiol |
|---|---|
| PubChem CID | 116995861 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-(7-methyl-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinolin-6-yl)ethanethiol |
| SMILES | CN1CCc2cc3c(cc2C1CCS)OCCO3 |
| InChI | InChI=1S/C14H19NO2S/c1-15-4-2-10-8-13-14(17-6-5-16-13)9-11(10)12(15)3-7-18/h8-9,12,18H,2-7H2,1H3 |
| InChIKey | XKUWRYDNPKXWRE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 21.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|