C27H32Cl2N4O4S — CID 11699838
[4-[2-(2,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylcarbamoyl)imidazol-1-yl]phenyl] 3-methylbutane-1-sulfonate (PubChem CID 11699838) has the molecular formula C27H32Cl2N4O4S and a molecular weight of 579.55 g/mol. Its IUPAC name is [4-[2-(2,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylcarbamoyl)imidazol-1-yl]phenyl] 3-methylbutane-1-sulfonate.
| Compound Name | [4-[2-(2,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylcarbamoyl)imidazol-1-yl]phenyl] 3-methylbutane-1-sulfonate |
|---|---|
| PubChem CID | 11699838 |
| Molecular Formula | C27H32Cl2N4O4S |
| Molecular Weight | 579.55 g/mol |
| Exact Mass | 578.15 |
| IUPAC Name | [4-[2-(2,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylcarbamoyl)imidazol-1-yl]phenyl] 3-methylbutane-1-sulfonate |
| SMILES | Cc1c(C(=O)NN2CCCCC2)nc(-c2ccc(Cl)cc2Cl)n1-c1ccc(OS(=O)(=O)CCC(C)C)cc1 |
| InChI | InChI=1S/C27H32Cl2N4O4S/c1-18(2)13-16-38(35,36)37-22-10-8-21(9-11-22)33-19(3)25(27(34)31-32-14-5-4-6-15-32)30-26(33)23-12-7-20(28)17-24(23)29/h7-12,17-18H,4-6,13-16H2,1-3H3,(H,31,34) |
| InChIKey | AMNLOZBNQZKYPQ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.55 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|