C29H32O13 — CID 11699888
ethyl (1R,3R,4S,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4-dihydroxy-5-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylate (PubChem CID 11699888) has the molecular formula C29H32O13 and a molecular weight of 588.56 g/mol. Its IUPAC name is ethyl (1R,3R,4S,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4-dihydroxy-5-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylate.
| Compound Name | ethyl (1R,3R,4S,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4-dihydroxy-5-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11699888 |
| Molecular Formula | C29H32O13 |
| Molecular Weight | 588.56 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | ethyl (1R,3R,4S,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4-dihydroxy-5-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(O)C[C@@H](OC(=O)/C=C/c2ccc(O)c(O)c2)[C@H](O)[C@H](OC(=O)/C=C/c2cc(OC)c(O)c(OC)c2)C1 |
| InChI | InChI=1S/C29H32O13/c1-4-40-28(36)29(37)14-22(41-24(32)9-6-16-5-8-18(30)19(31)11-16)27(35)23(15-29)42-25(33)10-7-17-12-20(38-2)26(34)21(13-17)39-3/h5-13,22-23,27,30-31,34-35,37H,4,14-15H2,1-3H3/b9-6+,10-7+/t22-,23-,27+,29-/m1/s1 |
| InChIKey | QRWMZZNSGRCHHG-SCEVIUHRSA-N |
| XLogP | 1.82 |
| TPSA | 198.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.56 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|