C19H24O9 — CID 162973012
ethyl (1S,3R,4S,5R)-1,3,4-trihydroxy-5-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxy]cyclohexane-1-carboxylate (PubChem CID 162973012) has the molecular formula C19H24O9 and a molecular weight of 396.39 g/mol. Its IUPAC name is ethyl (1S,3R,4S,5R)-1,3,4-trihydroxy-5-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxy]cyclohexane-1-carboxylate.
| Compound Name | ethyl (1S,3R,4S,5R)-1,3,4-trihydroxy-5-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 162973012 |
| Molecular Formula | C19H24O9 |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | ethyl (1S,3R,4S,5R)-1,3,4-trihydroxy-5-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxy]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(O)C[C@@H](O)[C@H](O)[C@H](OC(=O)C=Cc2ccc(O)c(OC)c2)C1 |
| InChI | InChI=1S/C19H24O9/c1-3-27-18(24)19(25)9-13(21)17(23)15(10-19)28-16(22)7-5-11-4-6-12(20)14(8-11)26-2/h4-8,13,15,17,20-21,23,25H,3,9-10H2,1-2H3/t13-,15-,17+,19+/m1/s1 |
| InChIKey | RSAGVEOPIVWXRD-OVLVRJBISA-N |
| XLogP | 0.14 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|