C13H16FNO3 — CID 117002649
2-[1-(2-fluorophenyl)-3-hydroxypiperidin-3-yl]acetic acid (PubChem CID 117002649) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is 2-[1-(2-fluorophenyl)-3-hydroxypiperidin-3-yl]acetic acid.
| Compound Name | 2-[1-(2-fluorophenyl)-3-hydroxypiperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 117002649 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-[1-(2-fluorophenyl)-3-hydroxypiperidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1(O)CCCN(c2ccccc2F)C1 |
| InChI | InChI=1S/C13H16FNO3/c14-10-4-1-2-5-11(10)15-7-3-6-13(18,9-15)8-12(16)17/h1-2,4-5,18H,3,6-9H2,(H,16,17) |
| InChIKey | ADMQPTHSHHWWOC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |