C8H16N2O3S — CID 117003050
2-(oxolan-2-ylmethyl)-1,2,6-thiadiazinane 1,1-dioxide (PubChem CID 117003050) has the molecular formula C8H16N2O3S and a molecular weight of 220.29 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethyl)-1,2,6-thiadiazinane 1,1-dioxide.
| Compound Name | 2-(oxolan-2-ylmethyl)-1,2,6-thiadiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 117003050 |
| Molecular Formula | C8H16N2O3S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 2-(oxolan-2-ylmethyl)-1,2,6-thiadiazinane 1,1-dioxide |
| SMILES | O=S1(=O)NCCCN1CC1CCCO1 |
| InChI | InChI=1S/C8H16N2O3S/c11-14(12)9-4-2-5-10(14)7-8-3-1-6-13-8/h8-9H,1-7H2 |
| InChIKey | OULKOYRIZGXXRQ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |