C11H15NO4 — CID 117008372
4-(furan-2-ylmethyl)-2-(2-hydroxyethyl)morpholin-3-one (PubChem CID 117008372) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 4-(furan-2-ylmethyl)-2-(2-hydroxyethyl)morpholin-3-one.
| Compound Name | 4-(furan-2-ylmethyl)-2-(2-hydroxyethyl)morpholin-3-one |
|---|---|
| PubChem CID | 117008372 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 4-(furan-2-ylmethyl)-2-(2-hydroxyethyl)morpholin-3-one |
| SMILES | O=C1C(CCO)OCCN1Cc1ccco1 |
| InChI | InChI=1S/C11H15NO4/c13-5-3-10-11(14)12(4-7-16-10)8-9-2-1-6-15-9/h1-2,6,10,13H,3-5,7-8H2 |
| InChIKey | ATFNUJDVDMESPM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |