C9H10BrNO3 — CID 82380170
5-(bromomethyl)-3-(furan-2-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 82380170) has the molecular formula C9H10BrNO3 and a molecular weight of 260.09 g/mol. Its IUPAC name is 5-(bromomethyl)-3-(furan-2-ylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | 5-(bromomethyl)-3-(furan-2-ylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 82380170 |
| Molecular Formula | C9H10BrNO3 |
| Molecular Weight | 260.09 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | 5-(bromomethyl)-3-(furan-2-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(CBr)CN1Cc1ccco1 |
| InChI | InChI=1S/C9H10BrNO3/c10-4-8-6-11(9(12)14-8)5-7-2-1-3-13-7/h1-3,8H,4-6H2 |
| InChIKey | IBYLATOSYAXOGQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.09 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|