C26H28N4O4 — CID 175739385
2,4,6,8-tetrakis(furan-2-ylmethyl)-2,4,6,8-tetrazatricyclo[3.3.1.13,7]decane (PubChem CID 175739385) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is 2,4,6,8-tetrakis(furan-2-ylmethyl)-2,4,6,8-tetrazatricyclo[3.3.1.13,7]decane.
| Compound Name | 2,4,6,8-tetrakis(furan-2-ylmethyl)-2,4,6,8-tetrazatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 175739385 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 2,4,6,8-tetrakis(furan-2-ylmethyl)-2,4,6,8-tetrazatricyclo[3.3.1.13,7]decane |
| SMILES | c1coc(CN2C3CC4N(Cc5ccco5)C2CC(N3Cc2ccco2)N4Cc2ccco2)c1 |
| InChI | InChI=1S/C26H28N4O4/c1-5-19(31-9-1)15-27-23-13-26-29(17-21-7-3-11-33-21)24(27)14-25(28(23)16-20-6-2-10-32-20)30(26)18-22-8-4-12-34-22/h1-12,23-26H,13-18H2 |
| InChIKey | GDQOCWXXQWMYMP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 65.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |