C13H19NO2 — CID 122269092
8-(furan-2-ylmethyl)-3-methoxy-8-azabicyclo[3.2.1]octane (PubChem CID 122269092) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 8-(furan-2-ylmethyl)-3-methoxy-8-azabicyclo[3.2.1]octane.
| Compound Name | 8-(furan-2-ylmethyl)-3-methoxy-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 122269092 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 8-(furan-2-ylmethyl)-3-methoxy-8-azabicyclo[3.2.1]octane |
| SMILES | COC1CC2CCC(C1)N2Cc1ccco1 |
| InChI | InChI=1S/C13H19NO2/c1-15-13-7-10-4-5-11(8-13)14(10)9-12-3-2-6-16-12/h2-3,6,10-11,13H,4-5,7-9H2,1H3 |
| InChIKey | LTIUNHRIXRQELG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 25.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |