C23H26N2O2 — CID 102466170
(3aR,7aR)-1,3-bis(furan-2-ylmethyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole (PubChem CID 102466170) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is (3aR,7aR)-1,3-bis(furan-2-ylmethyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole.
| Compound Name | (3aR,7aR)-1,3-bis(furan-2-ylmethyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole |
|---|---|
| PubChem CID | 102466170 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (3aR,7aR)-1,3-bis(furan-2-ylmethyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole |
| SMILES | c1ccc(C2N(Cc3ccco3)[C@@H]3CCCC[C@H]3N2Cc2ccco2)cc1 |
| InChI | InChI=1S/C23H26N2O2/c1-2-8-18(9-3-1)23-24(16-19-10-6-14-26-19)21-12-4-5-13-22(21)25(23)17-20-11-7-15-27-20/h1-3,6-11,14-15,21-23H,4-5,12-13,16-17H2/t21-,22-/m1/s1 |
| InChIKey | DOYYDJBFVDMOCC-FGZHOGPDSA-N |
| XLogP | 5.20 |
| TPSA | 32.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |