C11H16N2O2 — CID 117015329
4-(furan-2-ylmethyl)-1,4-diazocan-5-one (PubChem CID 117015329) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 4-(furan-2-ylmethyl)-1,4-diazocan-5-one.
| Compound Name | 4-(furan-2-ylmethyl)-1,4-diazocan-5-one |
|---|---|
| PubChem CID | 117015329 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 4-(furan-2-ylmethyl)-1,4-diazocan-5-one |
| SMILES | O=C1CCCNCCN1Cc1ccco1 |
| InChI | InChI=1S/C11H16N2O2/c14-11-4-1-5-12-6-7-13(11)9-10-3-2-8-15-10/h2-3,8,12H,1,4-7,9H2 |
| InChIKey | OHNHNXKXPMWTJG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |