3-butyl-2-oxo-1,3-oxazinane-5-carboxylic acid

C9H15NO4 — CID 117010250

IUPAC3-butyl-2-oxo-1,3-oxazinane-5-carboxylic acid
SMILESCCCCN1CC(C(=O)O)COC1=O
InChIInChI=1S/C9H15NO4/c1-2-3-4-10-5-7(8(11)12)6-14-9(10)13/h7H,2-6H2,1H3,(H,11,12)
InChIKeyMIHRWBPLYLYPEG-UHFFFAOYSA-N
MW201.22 g/mol
LogP0.94
Rot. Bonds4

About 3-butyl-2-oxo-1,3-oxazinane-5-carboxylic acid

3-butyl-2-oxo-1,3-oxazinane-5-carboxylic acid (PubChem CID 117010250) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is 3-butyl-2-oxo-1,3-oxazinane-5-carboxylic acid.

Molecular Properties

Compound Name3-butyl-2-oxo-1,3-oxazinane-5-carboxylic acid
PubChem CID117010250
Molecular FormulaC9H15NO4
Molecular Weight201.22 g/mol
Exact Mass201.10
IUPAC Name3-butyl-2-oxo-1,3-oxazinane-5-carboxylic acid
SMILESCCCCN1CC(C(=O)O)COC1=O
InChIInChI=1S/C9H15NO4/c1-2-3-4-10-5-7(8(11)12)6-14-9(10)13/h7H,2-6H2,1H3,(H,11,12)
InChIKeyMIHRWBPLYLYPEG-UHFFFAOYSA-N
XLogP0.94
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.22
LogP ≤ 50.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-butyl-2-oxo-1,3-oxazinane-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-butyl-2-oxo-1,3-oxazinane-5-carboxylic acid?
The IUPAC name of 3-butyl-2-oxo-1,3-oxazinane-5-carboxylic acid (CID 117010250) is 3-butyl-2-oxo-1,3-oxazinane-5-carboxylic acid.
What is the SMILES notation for 3-butyl-2-oxo-1,3-oxazinane-5-carboxylic acid?
The canonical SMILES for 3-butyl-2-oxo-1,3-oxazinane-5-carboxylic acid is CCCCN1CC(C(=O)O)COC1=O.
What is the InChIKey of 3-butyl-2-oxo-1,3-oxazinane-5-carboxylic acid?
The InChIKey is MIHRWBPLYLYPEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO4/c1-2-3-4-10-5-7(8(11)12)6-14-9(10)13/h7H,2-6H2,1H3,(H,11,12).
What are the key properties of 3-butyl-2-oxo-1,3-oxazinane-5-carboxylic acid?
3-butyl-2-oxo-1,3-oxazinane-5-carboxylic acid has a molecular weight of 201.22 g/mol, XLogP of 0.94, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-2-oxo-1,3-oxazinane-5-carboxylic acid is sourced from PubChem (CID 117010250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).