About 2-oxo-3-(3,3,3-trifluoropropyl)-1,3-oxazinane-5-carboxylic acid
2-oxo-3-(3,3,3-trifluoropropyl)-1,3-oxazinane-5-carboxylic acid (PubChem CID 83851059) has the molecular formula C8H10F3NO4
and a molecular weight of 241.16 g/mol. Its IUPAC name is 2-oxo-3-(3,3,3-trifluoropropyl)-1,3-oxazinane-5-carboxylic acid.
Analyze 2-oxo-3-(3,3,3-trifluoropropyl)-1,3-oxazinane-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-3-(3,3,3-trifluoropropyl)-1,3-oxazinane-5-carboxylic acid?
The IUPAC name of 2-oxo-3-(3,3,3-trifluoropropyl)-1,3-oxazinane-5-carboxylic acid (CID 83851059) is 2-oxo-3-(3,3,3-trifluoropropyl)-1,3-oxazinane-5-carboxylic acid.
What is the SMILES notation for 2-oxo-3-(3,3,3-trifluoropropyl)-1,3-oxazinane-5-carboxylic acid?
The canonical SMILES for 2-oxo-3-(3,3,3-trifluoropropyl)-1,3-oxazinane-5-carboxylic acid is O=C(O)C1COC(=O)N(CCC(F)(F)F)C1.
What is the InChIKey of 2-oxo-3-(3,3,3-trifluoropropyl)-1,3-oxazinane-5-carboxylic acid?
The InChIKey is LOWIYANFNRETOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3NO4/c9-8(10,11)1-2-12-3-5(6(13)14)4-16-7(12)15/h5H,1-4H2,(H,13,14).
What are the key properties of 2-oxo-3-(3,3,3-trifluoropropyl)-1,3-oxazinane-5-carboxylic acid?
2-oxo-3-(3,3,3-trifluoropropyl)-1,3-oxazinane-5-carboxylic acid has a molecular weight of 241.16 g/mol, XLogP of 1.09, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-3-(3,3,3-trifluoropropyl)-1,3-oxazinane-5-carboxylic acid is sourced from PubChem (CID 83851059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).