3-(2-methylpropyl)-2-oxo-1,3-oxazinane-5-carboxylic acid

C9H15NO4 — CID 83848062

IUPAC3-(2-methylpropyl)-2-oxo-1,3-oxazinane-5-carboxylic acid
SMILESCC(C)CN1CC(C(=O)O)COC1=O
InChIInChI=1S/C9H15NO4/c1-6(2)3-10-4-7(8(11)12)5-14-9(10)13/h6-7H,3-5H2,1-2H3,(H,11,12)
InChIKeyXCAQHIAYZPCSSB-UHFFFAOYSA-N
MW201.22 g/mol
LogP0.80
Rot. Bonds3

About 3-(2-methylpropyl)-2-oxo-1,3-oxazinane-5-carboxylic acid

3-(2-methylpropyl)-2-oxo-1,3-oxazinane-5-carboxylic acid (PubChem CID 83848062) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is 3-(2-methylpropyl)-2-oxo-1,3-oxazinane-5-carboxylic acid.

Molecular Properties

Compound Name3-(2-methylpropyl)-2-oxo-1,3-oxazinane-5-carboxylic acid
PubChem CID83848062
Molecular FormulaC9H15NO4
Molecular Weight201.22 g/mol
Exact Mass201.10
IUPAC Name3-(2-methylpropyl)-2-oxo-1,3-oxazinane-5-carboxylic acid
SMILESCC(C)CN1CC(C(=O)O)COC1=O
InChIInChI=1S/C9H15NO4/c1-6(2)3-10-4-7(8(11)12)5-14-9(10)13/h6-7H,3-5H2,1-2H3,(H,11,12)
InChIKeyXCAQHIAYZPCSSB-UHFFFAOYSA-N
XLogP0.80
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.22
LogP ≤ 50.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(2-methylpropyl)-2-oxo-1,3-oxazinane-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-methylpropyl)-2-oxo-1,3-oxazinane-5-carboxylic acid?
The IUPAC name of 3-(2-methylpropyl)-2-oxo-1,3-oxazinane-5-carboxylic acid (CID 83848062) is 3-(2-methylpropyl)-2-oxo-1,3-oxazinane-5-carboxylic acid.
What is the SMILES notation for 3-(2-methylpropyl)-2-oxo-1,3-oxazinane-5-carboxylic acid?
The canonical SMILES for 3-(2-methylpropyl)-2-oxo-1,3-oxazinane-5-carboxylic acid is CC(C)CN1CC(C(=O)O)COC1=O.
What is the InChIKey of 3-(2-methylpropyl)-2-oxo-1,3-oxazinane-5-carboxylic acid?
The InChIKey is XCAQHIAYZPCSSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO4/c1-6(2)3-10-4-7(8(11)12)5-14-9(10)13/h6-7H,3-5H2,1-2H3,(H,11,12).
What are the key properties of 3-(2-methylpropyl)-2-oxo-1,3-oxazinane-5-carboxylic acid?
3-(2-methylpropyl)-2-oxo-1,3-oxazinane-5-carboxylic acid has a molecular weight of 201.22 g/mol, XLogP of 0.80, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylpropyl)-2-oxo-1,3-oxazinane-5-carboxylic acid is sourced from PubChem (CID 83848062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).